C26H42O4 — CID 162812105
(E,2S)-4-methyl-2-[(2R,3S,5R,8R,9S,10S,13R,14S,15R,17R)-2,3,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-one (PubChem CID 162812105) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is (E,2S)-4-methyl-2-[(2R,3S,5R,8R,9S,10S,13R,14S,15R,17R)-2,3,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-one.
| Compound Name | (E,2S)-4-methyl-2-[(2R,3S,5R,8R,9S,10S,13R,14S,15R,17R)-2,3,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-one |
|---|---|
| PubChem CID | 162812105 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | (E,2S)-4-methyl-2-[(2R,3S,5R,8R,9S,10S,13R,14S,15R,17R)-2,3,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-one |
| SMILES | C/C=C(\C)C(=O)[C@@H](C)[C@H]1C[C@@H](O)[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)[C@H](O)C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H42O4/c1-6-14(2)24(30)15(3)19-12-21(28)23-17-8-7-16-11-20(27)22(29)13-26(16,5)18(17)9-10-25(19,23)4/h6,15-23,27-29H,7-13H2,1-5H3/b14-6+/t15-,16+,17+,18-,19+,20-,21+,22+,23+,25+,26-/m0/s1 |
| InChIKey | PBGZWRBVJMWXBT-CZYSGTNMSA-N |
| XLogP | 4.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|