C19H32O4Si — CID 11245118
(E,4S)-6-(5-oxo-2H-furan-3-yl)-4-tri(propan-2-yl)silyloxyhex-2-enal (PubChem CID 11245118) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (E,4S)-6-(5-oxo-2H-furan-3-yl)-4-tri(propan-2-yl)silyloxyhex-2-enal.
| Compound Name | (E,4S)-6-(5-oxo-2H-furan-3-yl)-4-tri(propan-2-yl)silyloxyhex-2-enal |
|---|---|
| PubChem CID | 11245118 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (E,4S)-6-(5-oxo-2H-furan-3-yl)-4-tri(propan-2-yl)silyloxyhex-2-enal |
| SMILES | CC(C)[Si](O[C@H](/C=C/C=O)CCC1=CC(=O)OC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32O4Si/c1-14(2)24(15(3)4,16(5)6)23-18(8-7-11-20)10-9-17-12-19(21)22-13-17/h7-8,11-12,14-16,18H,9-10,13H2,1-6H3/b8-7+/t18-/m1/s1 |
| InChIKey | OUDPYWSPXSUSSV-LKGOPFMKSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|