About 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan
2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan (PubChem CID 11245419) has the molecular formula C17H17NO8
and a molecular weight of 363.32 g/mol. Its IUPAC name is 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan.
Molecular Properties
| Compound Name | 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan |
| PubChem CID | 11245419 |
| Molecular Formula | C17H17NO8 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan |
| SMILES | O=[N+]([O-])CC(OCc1ccco1)(OCc1ccco1)OCc1ccco1 |
| InChI | InChI=1S/C17H17NO8/c19-18(20)13-17(24-10-14-4-1-7-21-14,25-11-15-5-2-8-22-15)26-12-16-6-3-9-23-16/h1-9H,10-13H2 |
| InChIKey | XHBYJFKNUMLOKO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan?
The IUPAC name of 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan (CID 11245419) is 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan.
What is the SMILES notation for 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan?
The canonical SMILES for 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan is O=[N+]([O-])CC(OCc1ccco1)(OCc1ccco1)OCc1ccco1.
What is the InChIKey of 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan?
The InChIKey is XHBYJFKNUMLOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO8/c19-18(20)13-17(24-10-14-4-1-7-21-14,25-11-15-5-2-8-22-15)26-12-16-6-3-9-23-16/h1-9H,10-13H2.
What are the key properties of 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan?
2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan has a molecular weight of 363.32 g/mol, XLogP of 3.35, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,1-bis(furan-2-ylmethoxy)-2-nitroethoxy]methyl]furan is sourced from PubChem (CID 11245419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).