C22H24N2O5 — CID 11246468
(5R,7R,8S,9R)-1,3-dibenzyl-8,9-dihydroxy-7-(hydroxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 11246468) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (5R,7R,8S,9R)-1,3-dibenzyl-8,9-dihydroxy-7-(hydroxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,7R,8S,9R)-1,3-dibenzyl-8,9-dihydroxy-7-(hydroxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 11246468 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (5R,7R,8S,9R)-1,3-dibenzyl-8,9-dihydroxy-7-(hydroxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N(Cc2ccccc2)C(=O)[C@]2(C[C@H](CO)[C@H](O)[C@@H]2O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O5/c25-14-17-11-22(19(27)18(17)26)20(28)23(12-15-7-3-1-4-8-15)21(29)24(22)13-16-9-5-2-6-10-16/h1-10,17-19,25-27H,11-14H2/t17-,18+,19+,22-/m1/s1 |
| InChIKey | AAQZJFPREXEMAK-MDPIYQRISA-N |
| XLogP | 1.12 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|