C12H12Cl3NO6S — CID 11246710
2,2,2-trichloroethyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 11246710) has the molecular formula C12H12Cl3NO6S and a molecular weight of 404.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11246710 |
| Molecular Formula | C12H12Cl3NO6S |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 2,2,2-trichloroethyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | COc1ccccc1[C@H]1COS(=O)(=O)N1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3NO6S/c1-20-10-5-3-2-4-8(10)9-6-22-23(18,19)16(9)11(17)21-7-12(13,14)15/h2-5,9H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | OYWXWKPBDZLMLT-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|