C13H15NO6S — CID 11301445
prop-2-enyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 11301445) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is prop-2-enyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | prop-2-enyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11301445 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | prop-2-enyl (4S)-4-(2-methoxyphenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | C=CCOC(=O)N1[C@@H](c2ccccc2OC)COS1(=O)=O |
| InChI | InChI=1S/C13H15NO6S/c1-3-8-19-13(15)14-11(9-20-21(14,16)17)10-6-4-5-7-12(10)18-2/h3-7,11H,1,8-9H2,2H3/t11-/m1/s1 |
| InChIKey | PZISJYJRSMLRJF-LLVKDONJSA-N |
| XLogP | 1.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|