C30H29N2O2P — CID 11248631
N-[(1Z,2S)-1-diphenylphosphorylimino-3-methyl-1-phenylbutan-2-yl]benzamide (PubChem CID 11248631) has the molecular formula C30H29N2O2P and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[(1Z,2S)-1-diphenylphosphorylimino-3-methyl-1-phenylbutan-2-yl]benzamide.
| Compound Name | N-[(1Z,2S)-1-diphenylphosphorylimino-3-methyl-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 11248631 |
| Molecular Formula | C30H29N2O2P |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[(1Z,2S)-1-diphenylphosphorylimino-3-methyl-1-phenylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1)/C(=N\P(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29N2O2P/c1-23(2)28(31-30(33)25-17-9-4-10-18-25)29(24-15-7-3-8-16-24)32-35(34,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28H,1-2H3,(H,31,33)/b32-29-/t28-/m0/s1 |
| InChIKey | DREDEDVVMNZIGT-VFBHOIQISA-N |
| XLogP | 5.86 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|