C30H35N3O3 — CID 11248737
(3S)-N-(4-pentylphenyl)-2-(2-propan-2-yloxypyridine-4-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11248737) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is (3S)-N-(4-pentylphenyl)-2-(2-propan-2-yloxypyridine-4-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(4-pentylphenyl)-2-(2-propan-2-yloxypyridine-4-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11248737 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | (3S)-N-(4-pentylphenyl)-2-(2-propan-2-yloxypyridine-4-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)[C@@H]2Cc3ccccc3CN2C(=O)c2ccnc(OC(C)C)c2)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-4-5-6-9-22-12-14-26(15-13-22)32-29(34)27-18-23-10-7-8-11-25(23)20-33(27)30(35)24-16-17-31-28(19-24)36-21(2)3/h7-8,10-17,19,21,27H,4-6,9,18,20H2,1-3H3,(H,32,34)/t27-/m0/s1 |
| InChIKey | PGZQYDHNPSNUGV-MHZLTWQESA-N |
| XLogP | 5.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|