C19H11F3N2O2S — CID 1124881
2-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione (PubChem CID 1124881) has the molecular formula C19H11F3N2O2S and a molecular weight of 388.37 g/mol. Its IUPAC name is 2-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1124881 |
| Molecular Formula | C19H11F3N2O2S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ncc(Cc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C19H11F3N2O2S/c20-19(21,22)12-5-3-4-11(8-12)9-13-10-23-18(27-13)24-16(25)14-6-1-2-7-15(14)17(24)26/h1-8,10H,9H2 |
| InChIKey | TWAJFHKCYFCBDJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|