C16H9F3KN3O3S2 — CID 23694717
potassium (2Z)-2-(2,4-dioxo-1,3-thiazolidin-3-id-5-ylidene)-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 23694717) has the molecular formula C16H9F3KN3O3S2 and a molecular weight of 451.49 g/mol. Its IUPAC name is potassium (2Z)-2-(2,4-dioxo-1,3-thiazolidin-3-id-5-ylidene)-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | potassium (2Z)-2-(2,4-dioxo-1,3-thiazolidin-3-id-5-ylidene)-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23694717 |
| Molecular Formula | C16H9F3KN3O3S2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | potassium (2Z)-2-(2,4-dioxo-1,3-thiazolidin-3-id-5-ylidene)-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(/C=C1\SC(=O)[N-]C1=O)Nc1ncc(Cc2cccc(C(F)(F)F)c2)s1.[K+] |
| InChI | InChI=1S/C16H10F3N3O3S2.K/c17-16(18,19)9-3-1-2-8(4-9)5-10-7-20-14(26-10)21-12(23)6-11-13(24)22-15(25)27-11;/h1-4,6-7H,5H2,(H2,20,21,22,23,24,25);/q;+1/p-1/b11-6-; |
| InChIKey | QZPDNUPFSURZBE-AVHZNCSWSA-M |
| XLogP | 1.35 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|