C29H33N5O3 — CID 11249049
1-[2-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]indazol-6-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 11249049) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-[2-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]indazol-6-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[2-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]indazol-6-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 11249049 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 1-[2-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]indazol-6-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1ccc2cn(CCCN3CCCC(CO)C3)nc2c1 |
| InChI | InChI=1S/C29H33N5O3/c35-21-22-6-4-15-33(19-22)16-5-17-34-20-23-9-10-25(18-28(23)32-34)31-29(36)30-24-11-13-27(14-12-24)37-26-7-2-1-3-8-26/h1-3,7-14,18,20,22,35H,4-6,15-17,19,21H2,(H2,30,31,36) |
| InChIKey | LDWUMNIIKQXNMZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |