C26H27N5O3 — CID 11259634
1-[1-[2-(3-hydroxypyrrolidin-1-yl)ethyl]indazol-5-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 11259634) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[1-[2-(3-hydroxypyrrolidin-1-yl)ethyl]indazol-5-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[1-[2-(3-hydroxypyrrolidin-1-yl)ethyl]indazol-5-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 11259634 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[1-[2-(3-hydroxypyrrolidin-1-yl)ethyl]indazol-5-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1ccc2c(cnn2CCN2CCC(O)C2)c1 |
| InChI | InChI=1S/C26H27N5O3/c32-22-12-13-30(18-22)14-15-31-25-11-8-21(16-19(25)17-27-31)29-26(33)28-20-6-9-24(10-7-20)34-23-4-2-1-3-5-23/h1-11,16-17,22,32H,12-15,18H2,(H2,28,29,33) |
| InChIKey | UBPLEALSOWOIFE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |