C27H29N5O2 — CID 11396908
1-[(4-phenoxyphenyl)methyl]-3-[1-(2-pyrrolidin-1-ylethyl)indazol-6-yl]urea (PubChem CID 11396908) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[(4-phenoxyphenyl)methyl]-3-[1-(2-pyrrolidin-1-ylethyl)indazol-6-yl]urea.
| Compound Name | 1-[(4-phenoxyphenyl)methyl]-3-[1-(2-pyrrolidin-1-ylethyl)indazol-6-yl]urea |
|---|---|
| PubChem CID | 11396908 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-[(4-phenoxyphenyl)methyl]-3-[1-(2-pyrrolidin-1-ylethyl)indazol-6-yl]urea |
| SMILES | O=C(NCc1ccc(Oc2ccccc2)cc1)Nc1ccc2cnn(CCN3CCCC3)c2c1 |
| InChI | InChI=1S/C27H29N5O2/c33-27(28-19-21-8-12-25(13-9-21)34-24-6-2-1-3-7-24)30-23-11-10-22-20-29-32(26(22)18-23)17-16-31-14-4-5-15-31/h1-3,6-13,18,20H,4-5,14-17,19H2,(H2,28,30,33) |
| InChIKey | SHSVOLDXXBHQPQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |