C28H30N4O3 — CID 59114406
1-[2-[(4-hydroxypiperidin-1-yl)methyl]-1-methylindol-5-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 59114406) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 1-[2-[(4-hydroxypiperidin-1-yl)methyl]-1-methylindol-5-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[2-[(4-hydroxypiperidin-1-yl)methyl]-1-methylindol-5-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 59114406 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 1-[2-[(4-hydroxypiperidin-1-yl)methyl]-1-methylindol-5-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | Cn1c(CN2CCC(O)CC2)cc2cc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C28H30N4O3/c1-31-23(19-32-15-13-24(33)14-16-32)18-20-17-22(9-12-27(20)31)30-28(34)29-21-7-10-26(11-8-21)35-25-5-3-2-4-6-25/h2-12,17-18,24,33H,13-16,19H2,1H3,(H2,29,30,34) |
| InChIKey | OCNNJGQWIKUIOW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |