C34H34N4O2 — CID 59114396
1-[1-methyl-2-[(4-phenylpiperidin-1-yl)methyl]indol-5-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 59114396) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-[1-methyl-2-[(4-phenylpiperidin-1-yl)methyl]indol-5-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[1-methyl-2-[(4-phenylpiperidin-1-yl)methyl]indol-5-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 59114396 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 1-[1-methyl-2-[(4-phenylpiperidin-1-yl)methyl]indol-5-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | Cn1c(CN2CCC(c3ccccc3)CC2)cc2cc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C34H34N4O2/c1-37-30(24-38-20-18-26(19-21-38)25-8-4-2-5-9-25)23-27-22-29(14-17-33(27)37)36-34(39)35-28-12-15-32(16-13-28)40-31-10-6-3-7-11-31/h2-17,22-23,26H,18-21,24H2,1H3,(H2,35,36,39) |
| InChIKey | JCWFBCAWJCHCPA-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |