C21H19N5O2 — CID 90879086
1-(1-methylindazol-5-yl)-3-[4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea (PubChem CID 90879086) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-(1-methylindazol-5-yl)-3-[4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea.
| Compound Name | 1-(1-methylindazol-5-yl)-3-[4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 90879086 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-(1-methylindazol-5-yl)-3-[4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea |
| SMILES | Cc1cc(Oc2ccc(NC(=O)Nc3ccc4c(cnn4C)c3)cc2)ccn1 |
| InChI | InChI=1S/C21H19N5O2/c1-14-11-19(9-10-22-14)28-18-6-3-16(4-7-18)24-21(27)25-17-5-8-20-15(12-17)13-23-26(20)2/h3-13H,1-2H3,(H2,24,25,27) |
| InChIKey | VHPMAOSBPMCIJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |