C21H19N5O4 — CID 123235839
1-[3-[[2-(dihydroxymethyl)-4-pyridinyl]oxy]phenyl]-3-(1-methylindazol-5-yl)urea (PubChem CID 123235839) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 1-[3-[[2-(dihydroxymethyl)-4-pyridinyl]oxy]phenyl]-3-(1-methylindazol-5-yl)urea.
| Compound Name | 1-[3-[[2-(dihydroxymethyl)-4-pyridinyl]oxy]phenyl]-3-(1-methylindazol-5-yl)urea |
|---|---|
| PubChem CID | 123235839 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[3-[[2-(dihydroxymethyl)-4-pyridinyl]oxy]phenyl]-3-(1-methylindazol-5-yl)urea |
| SMILES | Cn1ncc2cc(NC(=O)Nc3cccc(Oc4ccnc(C(O)O)c4)c3)ccc21 |
| InChI | InChI=1S/C21H19N5O4/c1-26-19-6-5-15(9-13(19)12-23-26)25-21(29)24-14-3-2-4-16(10-14)30-17-7-8-22-18(11-17)20(27)28/h2-12,20,27-28H,1H3,(H2,24,25,29) |
| InChIKey | ZIGPYACPJUCWKD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|