C21H20N4O5 — CID 166653931
1-(1,3-benzodioxol-5-yl)-3-[4-[[2-[hydroxy(methylamino)methyl]-4-pyridinyl]oxy]phenyl]urea (PubChem CID 166653931) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-[[2-[hydroxy(methylamino)methyl]-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[[2-[hydroxy(methylamino)methyl]-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 166653931 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[[2-[hydroxy(methylamino)methyl]-4-pyridinyl]oxy]phenyl]urea |
| SMILES | CNC(O)c1cc(Oc2ccc(NC(=O)Nc3ccc4c(c3)OCO4)cc2)ccn1 |
| InChI | InChI=1S/C21H20N4O5/c1-22-20(26)17-11-16(8-9-23-17)30-15-5-2-13(3-6-15)24-21(27)25-14-4-7-18-19(10-14)29-12-28-18/h2-11,20,22,26H,12H2,1H3,(H2,24,25,27) |
| InChIKey | CYDNTGUPXRMQQE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|