C22H15F3N6O2 — CID 10049516
1-[4-[(2-cyano-4-pyridinyl)oxy]-2-(trifluoromethyl)phenyl]-3-(1-methylindazol-5-yl)urea (PubChem CID 10049516) has the molecular formula C22H15F3N6O2 and a molecular weight of 452.40 g/mol. Its IUPAC name is 1-[4-[(2-cyano-4-pyridinyl)oxy]-2-(trifluoromethyl)phenyl]-3-(1-methylindazol-5-yl)urea.
| Compound Name | 1-[4-[(2-cyano-4-pyridinyl)oxy]-2-(trifluoromethyl)phenyl]-3-(1-methylindazol-5-yl)urea |
|---|---|
| PubChem CID | 10049516 |
| Molecular Formula | C22H15F3N6O2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 1-[4-[(2-cyano-4-pyridinyl)oxy]-2-(trifluoromethyl)phenyl]-3-(1-methylindazol-5-yl)urea |
| SMILES | Cn1ncc2cc(NC(=O)Nc3ccc(Oc4ccnc(C#N)c4)cc3C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H15F3N6O2/c1-31-20-5-2-14(8-13(20)12-28-31)29-21(32)30-19-4-3-16(10-18(19)22(23,24)25)33-17-6-7-27-15(9-17)11-26/h2-10,12H,1H3,(H2,29,30,32) |
| InChIKey | RBZZHAJGQDKAST-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |