C23H16ClF3N6O4 — CID 66550823
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]-2-nitrophenyl]urea (PubChem CID 66550823) has the molecular formula C23H16ClF3N6O4 and a molecular weight of 532.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]-2-nitrophenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]-2-nitrophenyl]urea |
|---|---|
| PubChem CID | 66550823 |
| Molecular Formula | C23H16ClF3N6O4 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]-2-nitrophenyl]urea |
| SMILES | Cn1cc(-c2cc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)c([N+](=O)[O-])c3)ccn2)cn1 |
| InChI | InChI=1S/C23H16ClF3N6O4/c1-32-12-13(11-29-32)20-9-16(6-7-28-20)37-15-3-5-19(21(10-15)33(35)36)31-22(34)30-14-2-4-18(24)17(8-14)23(25,26)27/h2-12H,1H3,(H2,30,31,34) |
| InChIKey | TUIGCWFPBQJAGX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|