C23H19ClF3N5OS — CID 163934804
2-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-5-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]benzenethiol (PubChem CID 163934804) has the molecular formula C23H19ClF3N5OS and a molecular weight of 505.95 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-5-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]benzenethiol.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-5-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]benzenethiol |
|---|---|
| PubChem CID | 163934804 |
| Molecular Formula | C23H19ClF3N5OS |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-5-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]benzenethiol |
| SMILES | Cn1cc(-c2cc(Oc3ccc(NCNc4ccc(Cl)c(C(F)(F)F)c4)c(S)c3)ccn2)cn1 |
| InChI | InChI=1S/C23H19ClF3N5OS/c1-32-12-14(11-31-32)21-9-17(6-7-28-21)33-16-3-5-20(22(34)10-16)30-13-29-15-2-4-19(24)18(8-15)23(25,26)27/h2-12,29-30,34H,13H2,1H3 |
| InChIKey | RLTWZGDZAKDCNY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|