C16H20N6O — CID 118761819
1-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]-3-(1-methylindazol-5-yl)urea (PubChem CID 118761819) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]-3-(1-methylindazol-5-yl)urea.
| Compound Name | 1-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]-3-(1-methylindazol-5-yl)urea |
|---|---|
| PubChem CID | 118761819 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]-3-(1-methylindazol-5-yl)urea |
| SMILES | Cc1nccn1CCN(C)C(=O)Nc1ccc2c(cnn2C)c1 |
| InChI | InChI=1S/C16H20N6O/c1-12-17-6-7-22(12)9-8-20(2)16(23)19-14-4-5-15-13(10-14)11-18-21(15)3/h4-7,10-11H,8-9H2,1-3H3,(H,19,23) |
| InChIKey | UDENMONXVAILPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |