C17H23N5O3 — CID 86794424
3-(2,4-dimethyl-5-nitrophenyl)-1-methyl-1-[3-(2-methylimidazol-1-yl)propyl]urea (PubChem CID 86794424) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-(2,4-dimethyl-5-nitrophenyl)-1-methyl-1-[3-(2-methylimidazol-1-yl)propyl]urea.
| Compound Name | 3-(2,4-dimethyl-5-nitrophenyl)-1-methyl-1-[3-(2-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 86794424 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 3-(2,4-dimethyl-5-nitrophenyl)-1-methyl-1-[3-(2-methylimidazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NC(=O)N(C)CCCn1ccnc1C |
| InChI | InChI=1S/C17H23N5O3/c1-12-10-13(2)16(22(24)25)11-15(12)19-17(23)20(4)7-5-8-21-9-6-18-14(21)3/h6,9-11H,5,7-8H2,1-4H3,(H,19,23) |
| InChIKey | AFWGBDQIYFXMJC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|