C17H24N2O3S2 — CID 112503236
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 112503236) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 112503236 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)NCC(c2cccs2)N(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-13(2)22-14-7-9-15(10-8-14)24(20,21)18-12-16(19(3)4)17-6-5-11-23-17/h5-11,13,16,18H,12H2,1-4H3 |
| InChIKey | LDHZQHQUFXUIPF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |