C17H26N2O2 — CID 112503867
N-[2-(4-ethoxyphenyl)-2-piperidin-1-ylethyl]acetamide (PubChem CID 112503867) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)-2-piperidin-1-ylethyl]acetamide.
| Compound Name | N-[2-(4-ethoxyphenyl)-2-piperidin-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 112503867 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)-2-piperidin-1-ylethyl]acetamide |
| SMILES | CCOc1ccc(C(CNC(C)=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-21-16-9-7-15(8-10-16)17(13-18-14(2)20)19-11-5-4-6-12-19/h7-10,17H,3-6,11-13H2,1-2H3,(H,18,20) |
| InChIKey | ALFJKTMGYCAXJP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |