C19H25N3O2 — CID 112506054
1-cyclohexyl-3-[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]urea (PubChem CID 112506054) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]urea |
|---|---|
| PubChem CID | 112506054 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-cyclohexyl-3-[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)CCN2C(=O)C1CC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H25N3O2/c23-18(13-6-7-13)22-11-10-14-12-16(8-9-17(14)22)21-19(24)20-15-4-2-1-3-5-15/h8-9,12-13,15H,1-7,10-11H2,(H2,20,21,24) |
| InChIKey | WGBORDJBNFXTKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |