C20H23N3O3S — CID 20974765
1-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]-3-cyclopentylurea (PubChem CID 20974765) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]-3-cyclopentylurea.
| Compound Name | 1-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 20974765 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]-3-cyclopentylurea |
| SMILES | O=C(Nc1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1)NC1CCCC1 |
| InChI | InChI=1S/C20H23N3O3S/c24-20(21-16-6-4-5-7-16)22-17-10-11-19-15(14-17)12-13-23(19)27(25,26)18-8-2-1-3-9-18/h1-3,8-11,14,16H,4-7,12-13H2,(H2,21,22,24) |
| InChIKey | DVQKMRZTNAQAEF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |