C24H23N3O5S — CID 46389774
ethyl 2-[[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]carbamoylamino]benzoate (PubChem CID 46389774) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is ethyl 2-[[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 2-[[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46389774 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | ethyl 2-[[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Nc1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-2-32-23(28)20-10-6-7-11-21(20)26-24(29)25-18-12-13-22-17(16-18)14-15-27(22)33(30,31)19-8-4-3-5-9-19/h3-13,16H,2,14-15H2,1H3,(H2,25,26,29) |
| InChIKey | UEFRZORIJIDUFP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |