C36H59NO6Si — CID 11250639
tert-butyl (2S,3S,5R,6R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]-6,8-dimethyl-1-oxa-10-azaspiro[4.5]decane-10-carboxylate (PubChem CID 11250639) has the molecular formula C36H59NO6Si and a molecular weight of 629.96 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R,6R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]-6,8-dimethyl-1-oxa-10-azaspiro[4.5]decane-10-carboxylate.
| Compound Name | tert-butyl (2S,3S,5R,6R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]-6,8-dimethyl-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
|---|---|
| PubChem CID | 11250639 |
| Molecular Formula | C36H59NO6Si |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 629.41 |
| IUPAC Name | tert-butyl (2S,3S,5R,6R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]-6,8-dimethyl-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
| SMILES | C#CC[C@H](C)C[C@H](OCc1ccc(OC)cc1)[C@@H]1O[C@]2(C[C@@H]1O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H59NO6Si/c1-14-15-25(2)21-30(40-24-28-16-18-29(39-11)19-17-28)32-31(43-44(12,13)35(8,9)10)22-36(41-32)27(4)20-26(3)23-37(36)33(38)42-34(5,6)7/h1,16-19,25-27,30-32H,15,20-24H2,2-13H3/t25-,26-,27+,30-,31-,32-,36+/m0/s1 |
| InChIKey | FQRNUYWYIZECDF-OXKBKDPQSA-N |
| XLogP | 8.42 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|