C37H62INO5Si2 — CID 11505991
benzyl (2R,3R,5S,6S,8R)-2-[(1R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-iodo-3-methylhex-5-ynyl]-6,8-dimethyl-3-triethylsilyloxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate (PubChem CID 11505991) has the molecular formula C37H62INO5Si2 and a molecular weight of 783.98 g/mol. Its IUPAC name is benzyl (2R,3R,5S,6S,8R)-2-[(1R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-iodo-3-methylhex-5-ynyl]-6,8-dimethyl-3-triethylsilyloxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate.
| Compound Name | benzyl (2R,3R,5S,6S,8R)-2-[(1R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-iodo-3-methylhex-5-ynyl]-6,8-dimethyl-3-triethylsilyloxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
|---|---|
| PubChem CID | 11505991 |
| Molecular Formula | C37H62INO5Si2 |
| Molecular Weight | 783.98 g/mol |
| Exact Mass | 783.32 |
| IUPAC Name | benzyl (2R,3R,5S,6S,8R)-2-[(1R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-iodo-3-methylhex-5-ynyl]-6,8-dimethyl-3-triethylsilyloxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@]2(O[C@@H]1[C@@H](C[C@H](C)CC#CI)O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H62INO5Si2/c1-12-46(13-2,14-3)44-33-25-37(30(6)23-29(5)26-39(37)35(40)41-27-31-20-16-15-17-21-31)42-34(33)32(24-28(4)19-18-22-38)43-45(10,11)36(7,8)9/h15-17,20-21,28-30,32-34H,12-14,19,23-27H2,1-11H3/t28-,29-,30+,32-,33-,34-,37+/m1/s1 |
| InChIKey | NXMFOOUMMVBZBC-SHOCXOHGSA-N |
| XLogP | 10.38 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.98 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|