C41H55NO6 — CID 11954583
propyl (2R,3R,5S,6S,8R)-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-3-phenylmethoxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate (PubChem CID 11954583) has the molecular formula C41H55NO6 and a molecular weight of 657.89 g/mol. Its IUPAC name is propyl (2R,3R,5S,6S,8R)-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-3-phenylmethoxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate.
| Compound Name | propyl (2R,3R,5S,6S,8R)-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-3-phenylmethoxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
|---|---|
| PubChem CID | 11954583 |
| Molecular Formula | C41H55NO6 |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.40 |
| IUPAC Name | propyl (2R,3R,5S,6S,8R)-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-3-phenylmethoxy-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
| SMILES | CCCOC(=O)N1C[C@H](C)C[C@H](C)[C@@]12C[C@@H](OCc1ccccc1)[C@@H]([C@@H](C[C@H](C)CCOCc1ccccc1)OCc1ccccc1)O2 |
| InChI | InChI=1S/C41H55NO6/c1-5-22-45-40(43)42-27-32(3)24-33(4)41(42)26-38(47-30-36-19-13-8-14-20-36)39(48-41)37(46-29-35-17-11-7-12-18-35)25-31(2)21-23-44-28-34-15-9-6-10-16-34/h6-20,31-33,37-39H,5,21-30H2,1-4H3/t31-,32-,33+,37-,38-,39-,41+/m1/s1 |
| InChIKey | ZTXXJLUARBKNTF-DPADPEAISA-N |
| XLogP | 8.80 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|