C30H31NO5 — CID 102144018
(1R,6R,7S,8S,8aS)-1-ethenyl-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 102144018) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is (1R,6R,7S,8S,8aS)-1-ethenyl-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1R,6R,7S,8S,8aS)-1-ethenyl-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 102144018 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (1R,6R,7S,8S,8aS)-1-ethenyl-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C=C[C@H]1OC(=O)N2CC(OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C30H31NO5/c1-2-25-27-29(35-21-24-16-10-5-11-17-24)28(34-20-23-14-8-4-9-15-23)26(18-31(27)30(32)36-25)33-19-22-12-6-3-7-13-22/h2-17,25-29H,1,18-21H2/t25-,26?,27+,28+,29+/m1/s1 |
| InChIKey | ADNWNIKTHRDWHG-LOPAXYRASA-N |
| XLogP | 5.13 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|