C23H25NO5 — CID 11014743
(4S,6S,7S,8R,9R)-7,8-bis(phenylmethoxy)-5,11-dioxa-1-azatricyclo[7.3.0.04,6]dodecan-12-one (PubChem CID 11014743) has the molecular formula C23H25NO5 and a molecular weight of 395.45 g/mol. Its IUPAC name is (4S,6S,7S,8R,9R)-7,8-bis(phenylmethoxy)-5,11-dioxa-1-azatricyclo[7.3.0.04,6]dodecan-12-one.
| Compound Name | (4S,6S,7S,8R,9R)-7,8-bis(phenylmethoxy)-5,11-dioxa-1-azatricyclo[7.3.0.04,6]dodecan-12-one |
|---|---|
| PubChem CID | 11014743 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (4S,6S,7S,8R,9R)-7,8-bis(phenylmethoxy)-5,11-dioxa-1-azatricyclo[7.3.0.04,6]dodecan-12-one |
| SMILES | O=C1OC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]3O[C@H]3CCN12 |
| InChI | InChI=1S/C23H25NO5/c25-23-24-12-11-19-21(29-19)22(27-14-17-9-5-2-6-10-17)20(18(24)15-28-23)26-13-16-7-3-1-4-8-16/h1-10,18-22H,11-15H2/t18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | CKGULISRIRWLNN-TWGBQZSLSA-N |
| XLogP | 3.15 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|