C21H20N2O4 — CID 56927015
(5S,6S,7R,7aS)-3-oxo-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-5-carbonitrile (PubChem CID 56927015) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (5S,6S,7R,7aS)-3-oxo-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-5-carbonitrile.
| Compound Name | (5S,6S,7R,7aS)-3-oxo-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-5-carbonitrile |
|---|---|
| PubChem CID | 56927015 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (5S,6S,7R,7aS)-3-oxo-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-5-carbonitrile |
| SMILES | N#C[C@H]1[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]2COC(=O)N12 |
| InChI | InChI=1S/C21H20N2O4/c22-11-17-19(25-12-15-7-3-1-4-8-15)20(18-14-27-21(24)23(17)18)26-13-16-9-5-2-6-10-16/h1-10,17-20H,12-14H2/t17-,18-,19-,20+/m0/s1 |
| InChIKey | OGRDPZXGHNLJCQ-LWYYNNOASA-N |
| XLogP | 2.88 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |