C54H51NO6 — CID 126961882
benzyl (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine-1-carboxylate (PubChem CID 126961882) has the molecular formula C54H51NO6 and a molecular weight of 810.00 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126961882 |
| Molecular Formula | C54H51NO6 |
| Molecular Weight | 810.00 g/mol |
| Exact Mass | 809.37 |
| IUPAC Name | benzyl (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H51NO6/c56-53(60-40-45-28-14-4-15-29-45)55-36-50(57-37-42-22-8-1-9-23-42)52(59-39-44-26-12-3-13-27-44)51(58-38-43-24-10-2-11-25-43)49(55)41-61-54(46-30-16-5-17-31-46,47-32-18-6-19-33-47)48-34-20-7-21-35-48/h1-35,49-52H,36-41H2/t49-,50+,51-,52-/m1/s1 |
| InChIKey | RXBXUERLDVTTEM-HRHVFIINSA-N |
| XLogP | 10.77 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.00 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|