C30H47NO6Si — CID 102149895
2-trimethylsilylethyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate (PubChem CID 102149895) has the molecular formula C30H47NO6Si and a molecular weight of 545.79 g/mol. Its IUPAC name is 2-trimethylsilylethyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate.
| Compound Name | 2-trimethylsilylethyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 102149895 |
| Molecular Formula | C30H47NO6Si |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | 2-trimethylsilylethyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
| SMILES | C[C@@H]1C[C@H](C)[C@]2(C[C@H]3O[C@]4(COCc5ccccc5)C[C@@H](C)C[C@@H](O4)[C@H]3O2)N(C(=O)OCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C30H47NO6Si/c1-21-15-25-27-26(36-29(16-21,35-25)20-33-19-24-10-8-7-9-11-24)17-30(37-27)23(3)14-22(2)18-31(30)28(32)34-12-13-38(4,5)6/h7-11,21-23,25-27H,12-20H2,1-6H3/t21-,22+,23-,25+,26+,27+,29-,30+/m0/s1 |
| InChIKey | ANWKJIQSCCEBHV-GMPVHORPSA-N |
| XLogP | 6.05 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|