C25H41NO7Si — CID 11518881
benzyl (3aR,6R,7R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 11518881) has the molecular formula C25H41NO7Si and a molecular weight of 495.69 g/mol. Its IUPAC name is benzyl (3aR,6R,7R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aR,6R,7R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11518881 |
| Molecular Formula | C25H41NO7Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | benzyl (3aR,6R,7R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | COCO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2CN(C(=O)OCc2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H41NO7Si/c1-24(2,3)34(7,8)31-16-19-21(30-17-28-6)22-20(32-25(4,5)33-22)14-26(19)23(27)29-15-18-12-10-9-11-13-18/h9-13,19-22H,14-17H2,1-8H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | FWHOQQMCVSEARM-GXRSIYKFSA-N |
| XLogP | 4.54 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|