C32H41NO6 — CID 135055905
benzyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate (PubChem CID 135055905) has the molecular formula C32H41NO6 and a molecular weight of 535.68 g/mol. Its IUPAC name is benzyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate.
| Compound Name | benzyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 135055905 |
| Molecular Formula | C32H41NO6 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | benzyl (1R,2R,3'S,4R,5'R,6R,8S,10S)-3',5',10-trimethyl-8-(phenylmethoxymethyl)spiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
| SMILES | C[C@@H]1C[C@H](C)[C@]2(C[C@H]3O[C@]4(COCc5ccccc5)C[C@@H](C)C[C@@H](O4)[C@H]3O2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C32H41NO6/c1-22-15-27-29-28(38-31(16-22,37-27)21-35-19-25-10-6-4-7-11-25)17-32(39-29)24(3)14-23(2)18-33(32)30(34)36-20-26-12-8-5-9-13-26/h4-13,22-24,27-29H,14-21H2,1-3H3/t22-,23+,24-,27+,28+,29+,31-,32+/m0/s1 |
| InChIKey | NBZHABMQOZESRA-NAYHJSMRSA-N |
| XLogP | 5.91 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |