C33H45NO7 — CID 135078928
benzyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate (PubChem CID 135078928) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is benzyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate.
| Compound Name | benzyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate |
|---|---|
| PubChem CID | 135078928 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | benzyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate |
| SMILES | COC1([C@@H](C)C[C@@H](C)CNC(=O)OCc2ccccc2)C[C@H]2O[C@]3(COCc4ccccc4)C[C@@H](C)C[C@@H](O3)[C@H]2O1 |
| InChI | InChI=1S/C33H45NO7/c1-23-16-28-30-29(40-32(17-23,39-28)22-37-20-26-11-7-5-8-12-26)18-33(36-4,41-30)25(3)15-24(2)19-34-31(35)38-21-27-13-9-6-10-14-27/h5-14,23-25,28-30H,15-22H2,1-4H3,(H,34,35)/t23-,24+,25-,28+,29+,30+,32-,33?/m0/s1 |
| InChIKey | KKVDQKVXQNYVMX-GXYASJTASA-N |
| XLogP | 5.83 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |