C33H47NO8 — CID 15606064
benzyl (1R,2R,3'S,4S,5'R,6R,8S,10S)-8-(7-ethoxy-2,7-dioxoheptyl)-3',5',10-trimethylspiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate (PubChem CID 15606064) has the molecular formula C33H47NO8 and a molecular weight of 585.74 g/mol. Its IUPAC name is benzyl (1R,2R,3'S,4S,5'R,6R,8S,10S)-8-(7-ethoxy-2,7-dioxoheptyl)-3',5',10-trimethylspiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate.
| Compound Name | benzyl (1R,2R,3'S,4S,5'R,6R,8S,10S)-8-(7-ethoxy-2,7-dioxoheptyl)-3',5',10-trimethylspiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 15606064 |
| Molecular Formula | C33H47NO8 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | benzyl (1R,2R,3'S,4S,5'R,6R,8S,10S)-8-(7-ethoxy-2,7-dioxoheptyl)-3',5',10-trimethylspiro[3,7,12-trioxatricyclo[6.3.1.02,6]dodecane-4,2'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)CCCCC(=O)C[C@@]12C[C@@H](C)C[C@@H](O1)[C@H]1O[C@@]3(C[C@H]1O2)[C@@H](C)C[C@@H](C)CN3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H47NO8/c1-5-38-29(36)14-10-9-13-26(35)18-32-17-22(2)16-27(40-32)30-28(41-32)19-33(42-30)24(4)15-23(3)20-34(33)31(37)39-21-25-11-7-6-8-12-25/h6-8,11-12,22-24,27-28,30H,5,9-10,13-21H2,1-4H3/t22-,23+,24-,27+,28+,30+,32-,33-/m0/s1 |
| InChIKey | ZQGAECPZBXIOFC-OJVCGIQDSA-N |
| XLogP | 5.78 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|