C59H101NO10 — CID 171604217
8-O-benzyl 3-O-[1,17-dioxo-1,17-bis(3-pentyloctoxy)heptadecan-9-yl] (3S)-1,4-dioxa-8-azaspiro[4.5]decane-3,8-dicarboxylate (PubChem CID 171604217) has the molecular formula C59H101NO10 and a molecular weight of 984.45 g/mol. Its IUPAC name is 8-O-benzyl 3-O-[1,17-dioxo-1,17-bis(3-pentyloctoxy)heptadecan-9-yl] (3S)-1,4-dioxa-8-azaspiro[4.5]decane-3,8-dicarboxylate.
| Compound Name | 8-O-benzyl 3-O-[1,17-dioxo-1,17-bis(3-pentyloctoxy)heptadecan-9-yl] (3S)-1,4-dioxa-8-azaspiro[4.5]decane-3,8-dicarboxylate |
|---|---|
| PubChem CID | 171604217 |
| Molecular Formula | C59H101NO10 |
| Molecular Weight | 984.45 g/mol |
| Exact Mass | 983.74 |
| IUPAC Name | 8-O-benzyl 3-O-[1,17-dioxo-1,17-bis(3-pentyloctoxy)heptadecan-9-yl] (3S)-1,4-dioxa-8-azaspiro[4.5]decane-3,8-dicarboxylate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)OC(=O)[C@@H]1COC2(CCN(C(=O)OCc3ccccc3)CC2)O1 |
| InChI | InChI=1S/C59H101NO10/c1-5-9-20-30-50(31-21-10-6-2)40-46-65-55(61)38-28-17-13-15-26-36-53(37-27-16-14-18-29-39-56(62)66-47-41-51(32-22-11-7-3)33-23-12-8-4)69-57(63)54-49-68-59(70-54)42-44-60(45-43-59)58(64)67-48-52-34-24-19-25-35-52/h19,24-25,34-35,50-51,53-54H,5-18,20-23,26-33,36-49H2,1-4H3/t54-/m0/s1 |
| InChIKey | LCNNPBFGCGOGSY-XSMLMOGHSA-N |
| XLogP | 15.32 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.45 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|