C24H39NO7Si — CID 10885330
benzyl (3aS,4R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 10885330) has the molecular formula C24H39NO7Si and a molecular weight of 481.66 g/mol. Its IUPAC name is benzyl (3aS,4R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aS,4R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 10885330 |
| Molecular Formula | C24H39NO7Si |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | benzyl (3aS,4R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | COC1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H](CO)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H39NO7Si/c1-23(2,3)33(7,8)32-20-19-18(30-24(4,5)31-19)17(14-26)25(21(20)28-6)22(27)29-15-16-12-10-9-11-13-16/h9-13,17-21,26H,14-15H2,1-8H3/t17-,18+,19+,20-,21?/m1/s1 |
| InChIKey | ZDRQSTXVHQJWRT-IRWSCCLFSA-N |
| XLogP | 3.88 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|