C20H25FN2O2S — CID 112506670
N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-phenylethanesulfonamide (PubChem CID 112506670) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 112506670 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-phenylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCC(c1ccc(F)cc1)N1CCCC1 |
| InChI | InChI=1S/C20H25FN2O2S/c21-19-10-8-18(9-11-19)20(23-13-4-5-14-23)16-22-26(24,25)15-12-17-6-2-1-3-7-17/h1-3,6-11,20,22H,4-5,12-16H2 |
| InChIKey | WUAZIALLLUHLID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |