C29H51IO4Si2 — CID 11250772
[(1R,5S,6R,8R,10S,11S)-5-ethenyl-10-[(E)-4-iodopent-3-enyl]-5,6,10-trimethyl-11-triethylsilyloxy-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-en-1-yl]oxy-trimethylsilane (PubChem CID 11250772) has the molecular formula C29H51IO4Si2 and a molecular weight of 646.80 g/mol. Its IUPAC name is [(1R,5S,6R,8R,10S,11S)-5-ethenyl-10-[(E)-4-iodopent-3-enyl]-5,6,10-trimethyl-11-triethylsilyloxy-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(1R,5S,6R,8R,10S,11S)-5-ethenyl-10-[(E)-4-iodopent-3-enyl]-5,6,10-trimethyl-11-triethylsilyloxy-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11250772 |
| Molecular Formula | C29H51IO4Si2 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | [(1R,5S,6R,8R,10S,11S)-5-ethenyl-10-[(E)-4-iodopent-3-enyl]-5,6,10-trimethyl-11-triethylsilyloxy-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-en-1-yl]oxy-trimethylsilane |
| SMILES | C=C[C@]1(C)C2=C3[C@@H](C[C@H]1C)O[C@@](C)(CC/C=C(\C)I)[C@H](O[Si](CC)(CC)CC)[C@@]3(O[Si](C)(C)C)OC2 |
| InChI | InChI=1S/C29H51IO4Si2/c1-12-27(7)21(5)19-24-25-23(27)20-31-29(25,34-35(9,10)11)26(33-36(13-2,14-3)15-4)28(8,32-24)18-16-17-22(6)30/h12,17,21,24,26H,1,13-16,18-20H2,2-11H3/b22-17+/t21-,24-,26+,27+,28+,29-/m1/s1 |
| InChIKey | BVLHGQKVOCDNSI-BJNTXWIMSA-N |
| XLogP | 8.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|