C29H52O4Si2 — CID 11409826
triethyl-[[(1R,3R,4R,7E,11S,12S,13R)-3,4,7,11-tetramethyl-13-trimethylsilyloxy-14,18-dioxatetracyclo[9.6.1.04,16.013,17]octadeca-7,16-dien-12-yl]oxy]silane (PubChem CID 11409826) has the molecular formula C29H52O4Si2 and a molecular weight of 520.90 g/mol. Its IUPAC name is triethyl-[[(1R,3R,4R,7E,11S,12S,13R)-3,4,7,11-tetramethyl-13-trimethylsilyloxy-14,18-dioxatetracyclo[9.6.1.04,16.013,17]octadeca-7,16-dien-12-yl]oxy]silane.
| Compound Name | triethyl-[[(1R,3R,4R,7E,11S,12S,13R)-3,4,7,11-tetramethyl-13-trimethylsilyloxy-14,18-dioxatetracyclo[9.6.1.04,16.013,17]octadeca-7,16-dien-12-yl]oxy]silane |
|---|---|
| PubChem CID | 11409826 |
| Molecular Formula | C29H52O4Si2 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | triethyl-[[(1R,3R,4R,7E,11S,12S,13R)-3,4,7,11-tetramethyl-13-trimethylsilyloxy-14,18-dioxatetracyclo[9.6.1.04,16.013,17]octadeca-7,16-dien-12-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@]2(O[Si](C)(C)C)OCC3=C2[C@H]2C[C@@H](C)[C@@]3(C)CC/C(C)=C\CC[C@]1(C)O2 |
| InChI | InChI=1S/C29H52O4Si2/c1-11-35(12-2,13-3)32-26-28(7)17-14-15-21(4)16-18-27(6)22(5)19-24(31-28)25-23(27)20-30-29(25,26)33-34(8,9)10/h15,22,24,26H,11-14,16-20H2,1-10H3/b21-15-/t22-,24-,26+,27-,28+,29-/m1/s1 |
| InChIKey | FOCZCOWLDFEHBI-ZKVKDQNNSA-N |
| XLogP | 7.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|