C19H38O3Si2 — CID 91750798
trimethyl-[(2,6,6,10-tetramethyl-2-trimethylsilyloxy-1-oxaspiro[4.5]dec-9-en-8-yl)oxy]silane (PubChem CID 91750798) has the molecular formula C19H38O3Si2 and a molecular weight of 370.68 g/mol. Its IUPAC name is trimethyl-[(2,6,6,10-tetramethyl-2-trimethylsilyloxy-1-oxaspiro[4.5]dec-9-en-8-yl)oxy]silane.
| Compound Name | trimethyl-[(2,6,6,10-tetramethyl-2-trimethylsilyloxy-1-oxaspiro[4.5]dec-9-en-8-yl)oxy]silane |
|---|---|
| PubChem CID | 91750798 |
| Molecular Formula | C19H38O3Si2 |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | trimethyl-[(2,6,6,10-tetramethyl-2-trimethylsilyloxy-1-oxaspiro[4.5]dec-9-en-8-yl)oxy]silane |
| SMILES | CC1=CC(O[Si](C)(C)C)CC(C)(C)C12CCC(C)(O[Si](C)(C)C)O2 |
| InChI | InChI=1S/C19H38O3Si2/c1-15-13-16(20-23(5,6)7)14-17(2,3)19(15)12-11-18(4,21-19)22-24(8,9)10/h13,16H,11-12,14H2,1-10H3 |
| InChIKey | BVCQQQOKCRYHIH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|