C21H37O3SiZr- — CID 154374789
(8-ethenyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy-triethylsilane;zirconium (PubChem CID 154374789) has the molecular formula C21H37O3SiZr- and a molecular weight of 456.83 g/mol. Its IUPAC name is (8-ethenyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy-triethylsilane;zirconium.
| Compound Name | (8-ethenyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy-triethylsilane;zirconium |
|---|---|
| PubChem CID | 154374789 |
| Molecular Formula | C21H37O3SiZr- |
| Molecular Weight | 456.83 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (8-ethenyl-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy-triethylsilane;zirconium |
| SMILES | [H]/[C-]=C/C1(O[Si](CC)(CC)CC)C(C)=CC2(CC1(C)C)OC(C)C(C)O2.[Zr] |
| InChI | InChI=1S/C21H37O3Si.Zr/c1-10-21(24-25(11-2,12-3)13-4)16(5)14-20(15-19(21,8)9)22-17(6)18(7)23-20;/h1,10,14,17-18H,11-13,15H2,2-9H3;/q-1; |
| InChIKey | HDDMUGFTSHNHON-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|