C29H52O6Si — CID 23248538
tert-butyl-[(E)-5-[(1R,4S,5R,7S)-4-[2-(1,3-dioxolan-2-yl)ethyl]-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-enoxy]-dimethylsilane (PubChem CID 23248538) has the molecular formula C29H52O6Si and a molecular weight of 524.82 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[(1R,4S,5R,7S)-4-[2-(1,3-dioxolan-2-yl)ethyl]-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-[(1R,4S,5R,7S)-4-[2-(1,3-dioxolan-2-yl)ethyl]-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 23248538 |
| Molecular Formula | C29H52O6Si |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | tert-butyl-[(E)-5-[(1R,4S,5R,7S)-4-[2-(1,3-dioxolan-2-yl)ethyl]-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-enoxy]-dimethylsilane |
| SMILES | COCO[C@H]1C[C@@H](C)[C@](C)(CCC2OCCO2)C2=C1[C@@H](/C=C(\C)CCCO[Si](C)(C)C(C)(C)C)OC2 |
| InChI | InChI=1S/C29H52O6Si/c1-21(11-10-14-35-36(8,9)28(3,4)5)17-24-27-23(19-33-24)29(6,13-12-26-31-15-16-32-26)22(2)18-25(27)34-20-30-7/h17,22,24-26H,10-16,18-20H2,1-9H3/b21-17+/t22-,24-,25+,29+/m1/s1 |
| InChIKey | YWKCSMFLXXIBHO-YNWRUAEPSA-N |
| XLogP | 6.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|