C27H46O5Si — CID 11282996
(6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-1,3,5,6-tetrahydro-2-benzofuran-4-one (PubChem CID 11282996) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is (6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-1,3,5,6-tetrahydro-2-benzofuran-4-one.
| Compound Name | (6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-1,3,5,6-tetrahydro-2-benzofuran-4-one |
|---|---|
| PubChem CID | 11282996 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (6R,7R)-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-7-[2-(1,3-dioxolan-2-yl)ethyl]-6,7-dimethyl-1,3,5,6-tetrahydro-2-benzofuran-4-one |
| SMILES | C/C(=C\C1OCC2=C1C(=O)C[C@@H](C)[C@@]2(C)CCC1OCCO1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O5Si/c1-19(10-9-13-32-33(7,8)26(3,4)5)16-23-25-21(18-31-23)27(6,20(2)17-22(25)28)12-11-24-29-14-15-30-24/h16,20,23-24H,9-15,17-18H2,1-8H3/b19-16+/t20-,23?,27-/m1/s1 |
| InChIKey | IBWWWQISFINUDW-CMAMOIFNSA-N |
| XLogP | 6.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|