C30H54O7Si — CID 11226687
(5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 11226687) has the molecular formula C30H54O7Si and a molecular weight of 554.84 g/mol. Its IUPAC name is (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11226687 |
| Molecular Formula | C30H54O7Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | CCOC1=C(C(/C=C(\C)CCCO[Si](C)(C)C(C)(C)C)OCOC)C(=O)[C@](C)(CCC2OCCO2)[C@H](C)C1 |
| InChI | InChI=1S/C30H54O7Si/c1-11-33-25-20-23(3)30(7,15-14-26-34-17-18-35-26)28(31)27(25)24(36-21-32-8)19-22(2)13-12-16-37-38(9,10)29(4,5)6/h19,23-24,26H,11-18,20-21H2,1-10H3/b22-19+/t23-,24?,30-/m1/s1 |
| InChIKey | UZTHOECSVDYRMS-XJYMHNLUSA-N |
| XLogP | 6.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|